C50H36N4Pt — CID 164701917
CID 164701917 (PubChem CID 164701917) has the molecular formula C50H36N4Pt and a molecular weight of 887.94 g/mol.
| Compound Name | CID 164701917 |
|---|---|
| PubChem CID | 164701917 |
| Molecular Formula | C50H36N4Pt |
| Molecular Weight | 887.94 g/mol |
| Exact Mass | 887.26 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c(-n4c5[c-]c(-c6ccccn6)ccc5c5ccccc5c5ccccc5c5ccccc54)ccc3c3ccccc32)c1.[Pt+2] |
| InChI | InChI=1S/C50H36N4.Pt/c1-50(2,3)34-27-29-52-49(31-34)54-46-22-11-9-19-41(46)43-26-24-35(32-48(43)54)53-45-21-10-8-18-40(45)38-16-6-4-14-36(38)37-15-5-7-17-39(37)42-25-23-33(30-47(42)53)44-20-12-13-28-51-44;/h4-29,31H,1-3H3;/q-2;+2 |
| InChIKey | UNKXNNQGLXDMNM-UHFFFAOYSA-N |
| XLogP | 12.66 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.94 |
| LogP ≤ 5 | 12.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|