C41H26N2OPt — CID 164701894
CID 164701894 (PubChem CID 164701894) has the molecular formula C41H26N2OPt and a molecular weight of 757.75 g/mol.
| Compound Name | CID 164701894 |
|---|---|
| PubChem CID | 164701894 |
| Molecular Formula | C41H26N2OPt |
| Molecular Weight | 757.75 g/mol |
| Exact Mass | 757.17 |
| IUPAC Name | — |
| SMILES | Oc1ccccc1-c1[c-]c(-n2c3[c-]c(-c4ccccn4)ccc3c3ccccc3c3ccccc3c3ccccc32)ccc1.[Pt+2] |
| InChI | InChI=1S/C41H26N2O.Pt/c44-41-22-8-6-14-31(41)28-12-11-13-30(26-28)43-39-21-7-5-19-36(39)34-17-3-1-15-32(34)33-16-2-4-18-35(33)37-24-23-29(27-40(37)43)38-20-9-10-25-42-38;/h1-25,44H;/q-2;+2 |
| InChIKey | KOSGZXDEIPQYGB-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.75 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|