C37H24N4Pt — CID 153285522
2-(1-methylbenzimidazol-2-yl)-9-[3-(4-phenyl-2-pyridinyl)benzene-2-id-1-yl]-1H-carbazol-1-ide;platinum(2+) (PubChem CID 153285522) has the molecular formula C37H24N4Pt and a molecular weight of 719.71 g/mol. Its IUPAC name is 2-(1-methylbenzimidazol-2-yl)-9-[3-(4-phenyl-2-pyridinyl)benzene-2-id-1-yl]-1H-carbazol-1-ide;platinum(2+).
| Compound Name | 2-(1-methylbenzimidazol-2-yl)-9-[3-(4-phenyl-2-pyridinyl)benzene-2-id-1-yl]-1H-carbazol-1-ide;platinum(2+) |
|---|---|
| PubChem CID | 153285522 |
| Molecular Formula | C37H24N4Pt |
| Molecular Weight | 719.71 g/mol |
| Exact Mass | 719.16 |
| IUPAC Name | 2-(1-methylbenzimidazol-2-yl)-9-[3-(4-phenyl-2-pyridinyl)benzene-2-id-1-yl]-1H-carbazol-1-ide;platinum(2+) |
| SMILES | Cn1c(-c2[c-]c3c(cc2)c2ccccc2n3-c2[c-]c(-c3cc(-c4ccccc4)ccn3)ccc2)nc2ccccc21.[Pt+2] |
| InChI | InChI=1S/C37H24N4.Pt/c1-40-35-17-8-6-15-32(35)39-37(40)28-18-19-31-30-14-5-7-16-34(30)41(36(31)24-28)29-13-9-12-27(22-29)33-23-26(20-21-38-33)25-10-3-2-4-11-25;/h2-21,23H,1H3;/q-2;+2 |
| InChIKey | GAXIPFOEBFJNRL-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.71 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|