C43H28N4Pt — CID 153285370
2-(1-methylbenzimidazol-2-yl)-4,6-diphenyl-9-(3-pyridin-2-ylbenzene-2-id-1-yl)-1H-carbazol-1-ide;platinum(2+) (PubChem CID 153285370) has the molecular formula C43H28N4Pt and a molecular weight of 795.80 g/mol. Its IUPAC name is 2-(1-methylbenzimidazol-2-yl)-4,6-diphenyl-9-(3-pyridin-2-ylbenzene-2-id-1-yl)-1H-carbazol-1-ide;platinum(2+).
| Compound Name | 2-(1-methylbenzimidazol-2-yl)-4,6-diphenyl-9-(3-pyridin-2-ylbenzene-2-id-1-yl)-1H-carbazol-1-ide;platinum(2+) |
|---|---|
| PubChem CID | 153285370 |
| Molecular Formula | C43H28N4Pt |
| Molecular Weight | 795.80 g/mol |
| Exact Mass | 795.20 |
| IUPAC Name | 2-(1-methylbenzimidazol-2-yl)-4,6-diphenyl-9-(3-pyridin-2-ylbenzene-2-id-1-yl)-1H-carbazol-1-ide;platinum(2+) |
| SMILES | Cn1c(-c2[c-]c3c(c(-c4ccccc4)c2)c2cc(-c4ccccc4)ccc2n3-c2[c-]c(-c3ccccn3)ccc2)nc2ccccc21.[Pt+2] |
| InChI | InChI=1S/C43H28N4.Pt/c1-46-40-21-9-8-20-38(40)45-43(46)33-27-35(30-15-6-3-7-16-30)42-36-26-31(29-13-4-2-5-14-29)22-23-39(36)47(41(42)28-33)34-18-12-17-32(25-34)37-19-10-11-24-44-37;/h2-24,26-27H,1H3;/q-2;+2 |
| InChIKey | PXJVYMOQRRUQOH-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.80 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|