C33H27N3O2PtS — CID 153421014
9-(4-tert-butyl-2-pyridinyl)-2-[3-[(4-methyl-2-pyridinyl)sulfonyl]benzene-2-id-1-yl]-1H-carbazol-1-ide;platinum(2+) (PubChem CID 153421014) has the molecular formula C33H27N3O2PtS and a molecular weight of 724.74 g/mol. Its IUPAC name is 9-(4-tert-butyl-2-pyridinyl)-2-[3-[(4-methyl-2-pyridinyl)sulfonyl]benzene-2-id-1-yl]-1H-carbazol-1-ide;platinum(2+).
| Compound Name | 9-(4-tert-butyl-2-pyridinyl)-2-[3-[(4-methyl-2-pyridinyl)sulfonyl]benzene-2-id-1-yl]-1H-carbazol-1-ide;platinum(2+) |
|---|---|
| PubChem CID | 153421014 |
| Molecular Formula | C33H27N3O2PtS |
| Molecular Weight | 724.74 g/mol |
| Exact Mass | 724.15 |
| IUPAC Name | 9-(4-tert-butyl-2-pyridinyl)-2-[3-[(4-methyl-2-pyridinyl)sulfonyl]benzene-2-id-1-yl]-1H-carbazol-1-ide;platinum(2+) |
| SMILES | Cc1ccnc(S(=O)(=O)c2[c-]c(-c3[c-]c4c(cc3)c3ccccc3n4-c3cc(C(C)(C)C)ccn3)ccc2)c1.[Pt+2] |
| InChI | InChI=1S/C33H27N3O2S.Pt/c1-22-14-16-35-32(18-22)39(37,38)26-9-7-8-23(19-26)24-12-13-28-27-10-5-6-11-29(27)36(30(28)20-24)31-21-25(15-17-34-31)33(2,3)4;/h5-18,21H,1-4H3;/q-2;+2 |
| InChIKey | DPQSJORAXPLPLN-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.74 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|