C38H35N4O2PtS- — CID 167399335
CID 167399335 (PubChem CID 167399335) has the molecular formula C38H35N4O2PtS- and a molecular weight of 806.87 g/mol.
| Compound Name | CID 167399335 |
|---|---|
| PubChem CID | 167399335 |
| Molecular Formula | C38H35N4O2PtS- |
| Molecular Weight | 806.87 g/mol |
| Exact Mass | 806.21 |
| IUPAC Name | — |
| SMILES | Cc1cc2c(cc1C)[N@@+]1(C)[CH-][N@+]2(c2[c-]c(S(=O)(=O)c3[c-]c4c(cc3)c3ccccc3n4-c3cc(C(C)(C)C)ccn3)ccc2)C1.[Pt] |
| InChI | InChI=1S/C38H35N4O2S.Pt/c1-25-18-35-36(19-26(25)2)42(23-41(35,6)24-42)28-10-9-11-29(21-28)45(43,44)30-14-15-32-31-12-7-8-13-33(31)40(34(32)22-30)37-20-27(16-17-39-37)38(3,4)5;/h7-20,23H,24H2,1-6H3;/q-1;/t41-,42+;/m0./s1 |
| InChIKey | WGERCAMEWLWXPI-DBTARJIVSA-N |
| XLogP | 8.20 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.87 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|