C60H53N4Pt- — CID 167399428
CID 167399428 (PubChem CID 167399428) has the molecular formula C60H53N4Pt- and a molecular weight of 1025.19 g/mol.
| Compound Name | CID 167399428 |
|---|---|
| PubChem CID | 167399428 |
| Molecular Formula | C60H53N4Pt- |
| Molecular Weight | 1025.19 g/mol |
| Exact Mass | 1024.39 |
| IUPAC Name | — |
| SMILES | Cc1cc2c(cc1C)[N@+]1(c3[c-]c(C4(c5[c-]c6c(cc5)c5ccccc5n6-c5cc(C(C)(C)C)ccn5)c5ccccc5-c5ccccc54)cc(C(C)(C)C)c3)[CH-][N@@+]2(c2ccccc2)C1.[Pt] |
| InChI | InChI=1S/C60H53N4.Pt/c1-39-30-55-56(31-40(39)2)64(37-63(55,38-64)45-18-10-9-11-19-45)46-33-43(59(6,7)8)32-44(34-46)60(51-23-15-12-20-47(51)48-21-13-16-24-52(48)60)42-26-27-50-49-22-14-17-25-53(49)62(54(50)35-42)57-36-41(28-29-61-57)58(3,4)5;/h9-33,36-37H,38H2,1-8H3;/q-1;/t63-,64+;/m0./s1 |
| InChIKey | WVCROFOSFGRGJJ-DZFNIRHZSA-N |
| XLogP | 14.73 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1025.19 |
| LogP ≤ 5 | 14.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|