About CID 167399652
CID 167399652 (PubChem CID 167399652) has the molecular formula C40H39N4OPt-
and a molecular weight of 786.86 g/mol.
Molecular Properties
| Compound Name | CID 167399652 |
| PubChem CID | 167399652 |
| Molecular Formula | C40H39N4OPt- |
| Molecular Weight | 786.86 g/mol |
| Exact Mass | 786.28 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c([N@@+]56[CH-][N@@+](C)(C5)c5cc(C(C)(C)C)ccc56)ccc4)ccc3c3ccccc32)c1.[Pt] |
| InChI | InChI=1S/C40H39N4O.Pt/c1-39(2,3)27-15-18-36-37(21-27)43(7)25-44(36,26-43)29-11-10-12-30(23-29)45-31-16-17-33-32-13-8-9-14-34(32)42(35(33)24-31)38-22-28(19-20-41-38)40(4,5)6;/h8-22,25H,26H2,1-7H3;/q-1;/t43-,44+;/m0./s1 |
| InChIKey | LSHFEHGPEZYYON-FAAMGJFKSA-N |
| XLogP | 9.84 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 786.86 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze CID 167399652 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167399652?
The IUPAC name of CID 167399652 (CID 167399652) is not available.
What is the SMILES notation for CID 167399652?
The canonical SMILES for CID 167399652 is CC(C)(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c([N@@+]56[CH-][N@@+](C)(C5)c5cc(C(C)(C)C)ccc56)ccc4)ccc3c3ccccc32)c1.[Pt].
What is the InChIKey of CID 167399652?
The InChIKey is LSHFEHGPEZYYON-FAAMGJFKSA-N. The full InChI is InChI=1S/C40H39N4O.Pt/c1-39(2,3)27-15-18-36-37(21-27)43(7)25-44(36,26-43)29-11-10-12-30(23-29)45-31-16-17-33-32-13-8-9-14-34(32)42(35(33)24-31)38-22-28(19-20-41-38)40(4,5)6;/h8-22,25H,26H2,1-7H3;/q-1;/t43-,44+;/m0./s1.
What are the key properties of CID 167399652?
CID 167399652 has a molecular weight of 786.86 g/mol, XLogP of 9.84, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167399652 is sourced from PubChem (CID 167399652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).