About CID 167399469
CID 167399469 (PubChem CID 167399469) has the molecular formula C45H50N5Pt-
and a molecular weight of 856.01 g/mol.
Molecular Properties
| Compound Name | CID 167399469 |
| PubChem CID | 167399469 |
| Molecular Formula | C45H50N5Pt- |
| Molecular Weight | 856.01 g/mol |
| Exact Mass | 855.37 |
| IUPAC Name | — |
| SMILES | CN(c1[c-]c2c(cc1)c1ccccc1n2-c1cc(C(C)(C)C)ccn1)c1[c-]c([N@@+]23[CH-][N@@+](C)(C2)c2cc(C(C)(C)C)ccc23)cc(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C45H50N5.Pt/c1-43(2,3)30-16-19-40-41(24-30)49(11)28-50(40,29-49)35-23-32(45(7,8)9)22-34(26-35)47(10)33-17-18-37-36-14-12-13-15-38(36)48(39(37)27-33)42-25-31(20-21-46-42)44(4,5)6;/h12-25,28H,29H2,1-11H3;/q-1;/t49-,50+;/m0./s1 |
| InChIKey | GZHGCHDKTOALAO-FOZGCAMMSA-N |
| XLogP | 11.12 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 856.01 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze CID 167399469 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167399469?
The IUPAC name of CID 167399469 (CID 167399469) is not available.
What is the SMILES notation for CID 167399469?
The canonical SMILES for CID 167399469 is CN(c1[c-]c2c(cc1)c1ccccc1n2-c1cc(C(C)(C)C)ccn1)c1[c-]c([N@@+]23[CH-][N@@+](C)(C2)c2cc(C(C)(C)C)ccc23)cc(C(C)(C)C)c1.[Pt].
What is the InChIKey of CID 167399469?
The InChIKey is GZHGCHDKTOALAO-FOZGCAMMSA-N. The full InChI is InChI=1S/C45H50N5.Pt/c1-43(2,3)30-16-19-40-41(24-30)49(11)28-50(40,29-49)35-23-32(45(7,8)9)22-34(26-35)47(10)33-17-18-37-36-14-12-13-15-38(36)48(39(37)27-33)42-25-31(20-21-46-42)44(4,5)6;/h12-25,28H,29H2,1-11H3;/q-1;/t49-,50+;/m0./s1.
What are the key properties of CID 167399469?
CID 167399469 has a molecular weight of 856.01 g/mol, XLogP of 11.12, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167399469 is sourced from PubChem (CID 167399469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).