C54H53N4+ — CID 167399349
CID 167399349 (PubChem CID 167399349) has the molecular formula C54H53N4+ and a molecular weight of 758.05 g/mol.
| Compound Name | CID 167399349 |
|---|---|
| PubChem CID | 167399349 |
| Molecular Formula | C54H53N4+ |
| Molecular Weight | 758.05 g/mol |
| Exact Mass | 757.43 |
| IUPAC Name | — |
| SMILES | Cc1ccc2c(c1)[N@@+]1(C)[CH-][N@+]2(c2cc(C(C)(C)C)cc(C(c3ccccc3)(c3ccccc3)c3ccc4c5ccccc5n(-c5cc(C(C)(C)C)ccn5)c4c3)c2)C1 |
| InChI | InChI=1S/C54H53N4/c1-37-23-26-49-50(29-37)57(8)35-58(49,36-57)44-31-42(53(5,6)7)30-43(32-44)54(38-17-11-9-12-18-38,39-19-13-10-14-20-39)41-24-25-46-45-21-15-16-22-47(45)56(48(46)33-41)51-34-40(27-28-55-51)52(2,3)4/h9-35H,36H2,1-8H3/q+1/t57-,58+/m0/s1 |
| InChIKey | HSMOLGLCOPEAJO-GMXNEKCESA-N |
| XLogP | 13.14 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.05 |
| LogP ≤ 5 | 13.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|