C57H60N4 — CID 171771527
2-[[3-tert-butyl-5-(5-tert-butyl-3,6-dimethyl-2H-benzimidazol-1-yl)phenyl]-diphenylmethyl]-9-(4-tert-butyl-2-pyridinyl)carbazole (PubChem CID 171771527) has the molecular formula C57H60N4 and a molecular weight of 801.14 g/mol. Its IUPAC name is 2-[[3-tert-butyl-5-(5-tert-butyl-3,6-dimethyl-2H-benzimidazol-1-yl)phenyl]-diphenylmethyl]-9-(4-tert-butyl-2-pyridinyl)carbazole.
| Compound Name | 2-[[3-tert-butyl-5-(5-tert-butyl-3,6-dimethyl-2H-benzimidazol-1-yl)phenyl]-diphenylmethyl]-9-(4-tert-butyl-2-pyridinyl)carbazole |
|---|---|
| PubChem CID | 171771527 |
| Molecular Formula | C57H60N4 |
| Molecular Weight | 801.14 g/mol |
| Exact Mass | 800.48 |
| IUPAC Name | 2-[[3-tert-butyl-5-(5-tert-butyl-3,6-dimethyl-2H-benzimidazol-1-yl)phenyl]-diphenylmethyl]-9-(4-tert-butyl-2-pyridinyl)carbazole |
| SMILES | Cc1cc2c(cc1C(C)(C)C)N(C)CN2c1cc(C(C)(C)C)cc(C(c2ccccc2)(c2ccccc2)c2ccc3c4ccccc4n(-c4cc(C(C)(C)C)ccn4)c3c2)c1 |
| InChI | InChI=1S/C57H60N4/c1-38-30-52-51(36-48(38)56(8,9)10)59(11)37-60(52)45-32-43(55(5,6)7)31-44(33-45)57(39-20-14-12-15-21-39,40-22-16-13-17-23-40)42-26-27-47-46-24-18-19-25-49(46)61(50(47)34-42)53-35-41(28-29-58-53)54(2,3)4/h12-36H,37H2,1-11H3 |
| InChIKey | HMPMFRRMRIOSCV-UHFFFAOYSA-N |
| XLogP | 14.31 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.14 |
| LogP ≤ 5 | 14.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|