C53H52N4 — CID 155606511
2-[[3-tert-butyl-5-(3,5-dimethyl-2H-benzimidazol-1-yl)phenyl]-diphenylmethyl]-9-(4-tert-butyl-2-pyridinyl)carbazole (PubChem CID 155606511) has the molecular formula C53H52N4 and a molecular weight of 745.03 g/mol. Its IUPAC name is 2-[[3-tert-butyl-5-(3,5-dimethyl-2H-benzimidazol-1-yl)phenyl]-diphenylmethyl]-9-(4-tert-butyl-2-pyridinyl)carbazole.
| Compound Name | 2-[[3-tert-butyl-5-(3,5-dimethyl-2H-benzimidazol-1-yl)phenyl]-diphenylmethyl]-9-(4-tert-butyl-2-pyridinyl)carbazole |
|---|---|
| PubChem CID | 155606511 |
| Molecular Formula | C53H52N4 |
| Molecular Weight | 745.03 g/mol |
| Exact Mass | 744.42 |
| IUPAC Name | 2-[[3-tert-butyl-5-(3,5-dimethyl-2H-benzimidazol-1-yl)phenyl]-diphenylmethyl]-9-(4-tert-butyl-2-pyridinyl)carbazole |
| SMILES | Cc1ccc2c(c1)N(C)CN2c1cc(C(C)(C)C)cc(C(c2ccccc2)(c2ccccc2)c2ccc3c4ccccc4n(-c4cc(C(C)(C)C)ccn4)c3c2)c1 |
| InChI | InChI=1S/C53H52N4/c1-36-23-26-47-49(29-36)55(8)35-56(47)43-31-41(52(5,6)7)30-42(32-43)53(37-17-11-9-12-18-37,38-19-13-10-14-20-38)40-24-25-45-44-21-15-16-22-46(44)57(48(45)33-40)50-34-39(27-28-54-50)51(2,3)4/h9-34H,35H2,1-8H3 |
| InChIKey | GMCBJHYJRMSRLM-UHFFFAOYSA-N |
| XLogP | 13.01 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.03 |
| LogP ≤ 5 | 13.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|