C61H66N4 — CID 155651796
2-[[3-tert-butyl-5-[4-tert-butyl-3-(4-tert-butylphenyl)-2H-imidazol-1-yl]phenyl]-diphenylmethyl]-9-(4-tert-butyl-2-pyridinyl)carbazole (PubChem CID 155651796) has the molecular formula C61H66N4 and a molecular weight of 855.23 g/mol. Its IUPAC name is 2-[[3-tert-butyl-5-[4-tert-butyl-3-(4-tert-butylphenyl)-2H-imidazol-1-yl]phenyl]-diphenylmethyl]-9-(4-tert-butyl-2-pyridinyl)carbazole.
| Compound Name | 2-[[3-tert-butyl-5-[4-tert-butyl-3-(4-tert-butylphenyl)-2H-imidazol-1-yl]phenyl]-diphenylmethyl]-9-(4-tert-butyl-2-pyridinyl)carbazole |
|---|---|
| PubChem CID | 155651796 |
| Molecular Formula | C61H66N4 |
| Molecular Weight | 855.23 g/mol |
| Exact Mass | 854.53 |
| IUPAC Name | 2-[[3-tert-butyl-5-[4-tert-butyl-3-(4-tert-butylphenyl)-2H-imidazol-1-yl]phenyl]-diphenylmethyl]-9-(4-tert-butyl-2-pyridinyl)carbazole |
| SMILES | CC(C)(C)C1=CN(c2cc(C(C)(C)C)cc(C(c3ccccc3)(c3ccccc3)c3ccc4c5ccccc5n(-c5cc(C(C)(C)C)ccn5)c4c3)c2)CN1c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C61H66N4/c1-57(2,3)42-27-30-49(31-28-42)64-41-63(40-55(64)60(10,11)12)50-36-47(59(7,8)9)35-48(37-50)61(43-21-15-13-16-22-43,44-23-17-14-18-24-44)46-29-32-52-51-25-19-20-26-53(51)65(54(52)38-46)56-39-45(33-34-62-56)58(4,5)6/h13-40H,41H2,1-12H3 |
| InChIKey | YFLXIXKKQCBKEB-UHFFFAOYSA-N |
| XLogP | 15.63 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.23 |
| LogP ≤ 5 | 15.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|