About CID 167399482
CID 167399482 (PubChem CID 167399482) has the molecular formula C55H53N4+
and a molecular weight of 770.06 g/mol.
Molecular Properties
| Compound Name | CID 167399482 |
| PubChem CID | 167399482 |
| Molecular Formula | C55H53N4+ |
| Molecular Weight | 770.06 g/mol |
| Exact Mass | 769.43 |
| IUPAC Name | — |
| SMILES | Cc1cc2c(cc1C)[N@@+]1(C)[CH-][N@+]2(c2cc(C(C)(C)C)cc(C3(c4ccc5c6ccccc6n(-c6cc(C(C)(C)C)ccn6)c5c4)c4ccccc4-c4ccccc43)c2)C1 |
| InChI | InChI=1S/C55H53N4/c1-35-26-50-51(27-36(35)2)59(33-58(50,9)34-59)41-29-39(54(6,7)8)28-40(30-41)55(46-19-13-10-16-42(46)43-17-11-14-20-47(43)55)38-22-23-45-44-18-12-15-21-48(44)57(49(45)31-38)52-32-37(24-25-56-52)53(3,4)5/h10-33H,34H2,1-9H3/q+1/t58-,59+/m0/s1 |
| InChIKey | ZOFVURYIAVXGIV-XEYXCKRCSA-N |
| XLogP | 13.43 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 59 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 770.06 |
| LogP ≤ 5 | 13.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze CID 167399482 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167399482?
The IUPAC name of CID 167399482 (CID 167399482) is not available.
What is the SMILES notation for CID 167399482?
The canonical SMILES for CID 167399482 is Cc1cc2c(cc1C)[N@@+]1(C)[CH-][N@+]2(c2cc(C(C)(C)C)cc(C3(c4ccc5c6ccccc6n(-c6cc(C(C)(C)C)ccn6)c5c4)c4ccccc4-c4ccccc43)c2)C1.
What is the InChIKey of CID 167399482?
The InChIKey is ZOFVURYIAVXGIV-XEYXCKRCSA-N. The full InChI is InChI=1S/C55H53N4/c1-35-26-50-51(27-36(35)2)59(33-58(50,9)34-59)41-29-39(54(6,7)8)28-40(30-41)55(46-19-13-10-16-42(46)43-17-11-14-20-47(43)55)38-22-23-45-44-18-12-15-21-48(44)57(49(45)31-38)52-32-37(24-25-56-52)53(3,4)5/h10-33H,34H2,1-9H3/q+1/t58-,59+/m0/s1.
What are the key properties of CID 167399482?
CID 167399482 has a molecular weight of 770.06 g/mol, XLogP of 13.43, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167399482 is sourced from PubChem (CID 167399482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).