About CID 167399389
CID 167399389 (PubChem CID 167399389) has the molecular formula C53H49N4+
and a molecular weight of 742.00 g/mol.
Molecular Properties
| Compound Name | CID 167399389 |
| PubChem CID | 167399389 |
| Molecular Formula | C53H49N4+ |
| Molecular Weight | 742.00 g/mol |
| Exact Mass | 741.40 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-n2c3ccccc3c3ccc(C4(c5cccc([N@@+]67[CH-][N@@+](C)(C6)c6ccc(C(C)(C)C)cc67)c5)c5ccccc5-c5ccccc54)cc32)c1 |
| InChI | InChI=1S/C53H49N4/c1-51(2,3)35-24-26-48-49(31-35)57(33-56(48,7)34-57)39-16-14-15-37(29-39)53(44-20-11-8-17-40(44)41-18-9-12-21-45(41)53)38-23-25-43-42-19-10-13-22-46(42)55(47(43)30-38)50-32-36(27-28-54-50)52(4,5)6/h8-33H,34H2,1-7H3/q+1/t56-,57+/m0/s1 |
| InChIKey | UQDQXWWZRYBZPU-JBQXKKLXSA-N |
| XLogP | 12.82 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 742.00 |
| LogP ≤ 5 | 12.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze CID 167399389 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167399389?
The IUPAC name of CID 167399389 (CID 167399389) is not available.
What is the SMILES notation for CID 167399389?
The canonical SMILES for CID 167399389 is CC(C)(C)c1ccnc(-n2c3ccccc3c3ccc(C4(c5cccc([N@@+]67[CH-][N@@+](C)(C6)c6ccc(C(C)(C)C)cc67)c5)c5ccccc5-c5ccccc54)cc32)c1.
What is the InChIKey of CID 167399389?
The InChIKey is UQDQXWWZRYBZPU-JBQXKKLXSA-N. The full InChI is InChI=1S/C53H49N4/c1-51(2,3)35-24-26-48-49(31-35)57(33-56(48,7)34-57)39-16-14-15-37(29-39)53(44-20-11-8-17-40(44)41-18-9-12-21-45(41)53)38-23-25-43-42-19-10-13-22-46(42)55(47(43)30-38)50-32-36(27-28-54-50)52(4,5)6/h8-33H,34H2,1-7H3/q+1/t56-,57+/m0/s1.
What are the key properties of CID 167399389?
CID 167399389 has a molecular weight of 742.00 g/mol, XLogP of 12.82, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167399389 is sourced from PubChem (CID 167399389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).