C57H57N4Pt- — CID 167399723
CID 167399723 (PubChem CID 167399723) has the molecular formula C57H57N4Pt- and a molecular weight of 993.19 g/mol.
| Compound Name | CID 167399723 |
|---|---|
| PubChem CID | 167399723 |
| Molecular Formula | C57H57N4Pt- |
| Molecular Weight | 993.19 g/mol |
| Exact Mass | 992.42 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc(C(c2[c-]c3c(cc2)c2ccccc2n3-c2cc(C(C)(C)C)ccn2)(c2ccccc2)c2ccccc2)[c-]c([N@@+]23[CH-][N@@+](C)(C2)c2ccc(C(C)(C)C)cc23)c1.[Pt] |
| InChI | InChI=1S/C57H57N4.Pt/c1-54(2,3)41-26-28-51-52(35-41)61(37-60(51,10)38-61)46-32-44(56(7,8)9)31-45(33-46)57(39-19-13-11-14-20-39,40-21-15-12-16-22-40)43-25-27-48-47-23-17-18-24-49(47)59(50(48)34-43)53-36-42(29-30-58-53)55(4,5)6;/h11-32,35-37H,38H2,1-10H3;/q-1;/t60-,61+;/m0./s1 |
| InChIKey | CHOZYFAHBBNLKJ-KVXPPRDTSA-N |
| XLogP | 13.73 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 993.19 |
| LogP ≤ 5 | 13.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|