C38H35N4OPt- — CID 167399700
CID 167399700 (PubChem CID 167399700) has the molecular formula C38H35N4OPt- and a molecular weight of 758.80 g/mol.
| Compound Name | CID 167399700 |
|---|---|
| PubChem CID | 167399700 |
| Molecular Formula | C38H35N4OPt- |
| Molecular Weight | 758.80 g/mol |
| Exact Mass | 758.25 |
| IUPAC Name | — |
| SMILES | Cc1cc2c(cc1C)[N@@+]1(C)[CH-][N@+]2(c2[c-]c(Oc3[c-]c(-n4c5ccccc5c5cccnc54)ccc3)cc(C(C)(C)C)c2)C1.[Pt] |
| InChI | InChI=1S/C38H35N4O.Pt/c1-25-17-35-36(18-26(25)2)42(23-41(35,6)24-42)29-19-27(38(3,4)5)20-31(22-29)43-30-12-9-11-28(21-30)40-34-15-8-7-13-32(34)33-14-10-16-39-37(33)40;/h7-20,23H,24H2,1-6H3;/q-1;/t41-,42+;/m0./s1 |
| InChIKey | WMFKQXKCBPBCJJ-DBTARJIVSA-N |
| XLogP | 9.16 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.80 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|