C40H36N4OPt-2 — CID 168783710
9-[3-[3-[3-(3,5-ditert-butylphenyl)-2H-imidazol-3-ium-2-id-1-yl]benzene-2-id-1-yl]oxybenzene-2-id-1-yl]pyrido[2,3-b]indole;platinum (PubChem CID 168783710) has the molecular formula C40H36N4OPt-2 and a molecular weight of 783.83 g/mol. Its IUPAC name is 9-[3-[3-[3-(3,5-ditert-butylphenyl)-2H-imidazol-3-ium-2-id-1-yl]benzene-2-id-1-yl]oxybenzene-2-id-1-yl]pyrido[2,3-b]indole;platinum.
| Compound Name | 9-[3-[3-[3-(3,5-ditert-butylphenyl)-2H-imidazol-3-ium-2-id-1-yl]benzene-2-id-1-yl]oxybenzene-2-id-1-yl]pyrido[2,3-b]indole;platinum |
|---|---|
| PubChem CID | 168783710 |
| Molecular Formula | C40H36N4OPt-2 |
| Molecular Weight | 783.83 g/mol |
| Exact Mass | 783.25 |
| IUPAC Name | 9-[3-[3-[3-(3,5-ditert-butylphenyl)-2H-imidazol-3-ium-2-id-1-yl]benzene-2-id-1-yl]oxybenzene-2-id-1-yl]pyrido[2,3-b]indole;platinum |
| SMILES | CC(C)(C)c1cc(-[n+]2[c-]n(-c3[c-]c(Oc4[c-]c(-n5c6ccccc6c6cccnc65)ccc4)ccc3)cc2)cc(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C40H36N4O.Pt/c1-39(2,3)28-22-29(40(4,5)6)24-32(23-28)43-21-20-42(27-43)30-12-9-14-33(25-30)45-34-15-10-13-31(26-34)44-37-18-8-7-16-35(37)36-17-11-19-41-38(36)44;/h7-24H,1-6H3;/q-2; |
| InChIKey | MPVPSMREVLYGSD-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.83 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|