C43H32N4OPt — CID 164704190
11-[3-(7-tert-butylpyrido[2,3-b]indol-9-yl)benzene-2-id-1-yl]oxy-2-(2-methylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide;platinum(2+) (PubChem CID 164704190) has the molecular formula C43H32N4OPt and a molecular weight of 815.83 g/mol. Its IUPAC name is 11-[3-(7-tert-butylpyrido[2,3-b]indol-9-yl)benzene-2-id-1-yl]oxy-2-(2-methylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide;platinum(2+).
| Compound Name | 11-[3-(7-tert-butylpyrido[2,3-b]indol-9-yl)benzene-2-id-1-yl]oxy-2-(2-methylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide;platinum(2+) |
|---|---|
| PubChem CID | 164704190 |
| Molecular Formula | C43H32N4OPt |
| Molecular Weight | 815.83 g/mol |
| Exact Mass | 815.22 |
| IUPAC Name | 11-[3-(7-tert-butylpyrido[2,3-b]indol-9-yl)benzene-2-id-1-yl]oxy-2-(2-methylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide;platinum(2+) |
| SMILES | Cc1ccccc1-c1cn2c3ccccc3c3ccc(Oc4[c-]c(-n5c6cc(C(C)(C)C)ccc6c6cccnc65)ccc4)[c-]c3c2n1.[Pt+2] |
| InChI | InChI=1S/C43H32N4O.Pt/c1-27-11-5-6-14-32(27)38-26-46-39-17-8-7-15-34(39)33-21-19-31(25-37(33)42(46)45-38)48-30-13-9-12-29(24-30)47-40-23-28(43(2,3)4)18-20-35(40)36-16-10-22-44-41(36)47;/h5-23,26H,1-4H3;/q-2;+2 |
| InChIKey | AFCANJDNZKTZNQ-UHFFFAOYSA-N |
| XLogP | 10.80 |
| TPSA | 44.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.83 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|