C35H25N3OPt — CID 164704087
platinum(2+);11-(3-pyridin-2-ylbenzene-2-id-1-yl)oxy-2-(2,4,6-trimethylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide (PubChem CID 164704087) has the molecular formula C35H25N3OPt and a molecular weight of 698.68 g/mol. Its IUPAC name is platinum(2+);11-(3-pyridin-2-ylbenzene-2-id-1-yl)oxy-2-(2,4,6-trimethylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide.
| Compound Name | platinum(2+);11-(3-pyridin-2-ylbenzene-2-id-1-yl)oxy-2-(2,4,6-trimethylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide |
|---|---|
| PubChem CID | 164704087 |
| Molecular Formula | C35H25N3OPt |
| Molecular Weight | 698.68 g/mol |
| Exact Mass | 698.16 |
| IUPAC Name | platinum(2+);11-(3-pyridin-2-ylbenzene-2-id-1-yl)oxy-2-(2,4,6-trimethylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide |
| SMILES | Cc1cc(C)c(-c2cn3c4ccccc4c4ccc(Oc5[c-]c(-c6ccccn6)ccc5)[c-]c4c3n2)c(C)c1.[Pt+2] |
| InChI | InChI=1S/C35H25N3O.Pt/c1-22-17-23(2)34(24(3)18-22)32-21-38-33-13-5-4-11-29(33)28-15-14-27(20-30(28)35(38)37-32)39-26-10-8-9-25(19-26)31-12-6-7-16-36-31;/h4-18,21H,1-3H3;/q-2;+2 |
| InChIKey | LIHNQDAIQBEFFW-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.68 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|