About CID 164704242
CID 164704242 (PubChem CID 164704242) has the molecular formula C40H25N5OPt
and a molecular weight of 786.75 g/mol.
Molecular Properties
| Compound Name | CID 164704242 |
| PubChem CID | 164704242 |
| Molecular Formula | C40H25N5OPt |
| Molecular Weight | 786.75 g/mol |
| Exact Mass | 786.17 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c(-c2cn3c4cccnc4c4ccc(Oc5[c-]c6c(cc5)c5cccc7c8cccnc8n6c57)[c-]c4c3n2)c(C)c1.[Pt+2] |
| InChI | InChI=1S/C40H25N5O.Pt/c1-22-17-23(2)36(24(3)18-22)33-21-44-34-10-6-15-41-37(34)28-14-12-25(19-32(28)40(44)43-33)46-26-11-13-27-29-7-4-8-30-31-9-5-16-42-39(31)45(38(29)30)35(27)20-26;/h4-18,21H,1-3H3;/q-2;+2 |
| InChIKey | DAUJGJXYGYFTHA-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 56.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 786.75 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 164704242 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164704242?
The IUPAC name of CID 164704242 (CID 164704242) is not available.
What is the SMILES notation for CID 164704242?
The canonical SMILES for CID 164704242 is Cc1cc(C)c(-c2cn3c4cccnc4c4ccc(Oc5[c-]c6c(cc5)c5cccc7c8cccnc8n6c57)[c-]c4c3n2)c(C)c1.[Pt+2].
What is the InChIKey of CID 164704242?
The InChIKey is DAUJGJXYGYFTHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H25N5O.Pt/c1-22-17-23(2)36(24(3)18-22)33-21-44-34-10-6-15-41-37(34)28-14-12-25(19-32(28)40(44)43-33)46-26-11-13-27-29-7-4-8-30-31-9-5-16-42-39(31)45(38(29)30)35(27)20-26;/h4-18,21H,1-3H3;/q-2;+2.
What are the key properties of CID 164704242?
CID 164704242 has a molecular weight of 786.75 g/mol, XLogP of 9.56, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164704242 is sourced from PubChem (CID 164704242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).