About CID 164703843
CID 164703843 (PubChem CID 164703843) has the molecular formula C43H28N6OPt
and a molecular weight of 839.82 g/mol.
Molecular Properties
| Compound Name | CID 164703843 |
| PubChem CID | 164703843 |
| Molecular Formula | C43H28N6OPt |
| Molecular Weight | 839.82 g/mol |
| Exact Mass | 839.20 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c(-c2cn3c(n2)c2[c-]c(Oc4[c-]c5c(cc4)c4ncccc4n4cc(-c6ccccc6)nc54)ccc2c2cccnc23)c(C)c1.[Pt+2] |
| InChI | InChI=1S/C43H28N6O.Pt/c1-25-19-26(2)39(27(3)20-25)37-24-49-41-33(11-7-18-45-41)31-15-13-29(21-34(31)43(49)47-37)50-30-14-16-32-35(22-30)42-46-36(28-9-5-4-6-10-28)23-48(42)38-12-8-17-44-40(32)38;/h4-20,23-24H,1-3H3;/q-2;+2 |
| InChIKey | BLKNGIYQMDHSSD-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 69.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 839.82 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 164703843 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164703843?
The IUPAC name of CID 164703843 (CID 164703843) is not available.
What is the SMILES notation for CID 164703843?
The canonical SMILES for CID 164703843 is Cc1cc(C)c(-c2cn3c(n2)c2[c-]c(Oc4[c-]c5c(cc4)c4ncccc4n4cc(-c6ccccc6)nc54)ccc2c2cccnc23)c(C)c1.[Pt+2].
What is the InChIKey of CID 164703843?
The InChIKey is BLKNGIYQMDHSSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C43H28N6O.Pt/c1-25-19-26(2)39(27(3)20-25)37-24-49-41-33(11-7-18-45-41)31-15-13-29(21-34(31)43(49)47-37)50-30-14-16-32-35(22-30)42-46-36(28-9-5-4-6-10-28)23-48(42)38-12-8-17-44-40(32)38;/h4-20,23-24H,1-3H3;/q-2;+2.
What are the key properties of CID 164703843?
CID 164703843 has a molecular weight of 839.82 g/mol, XLogP of 10.03, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164703843 is sourced from PubChem (CID 164703843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).