C41H28N4OPt — CID 164703962
platinum(2+);11-(3-pyrido[2,3-b]indol-9-ylbenzene-2-id-1-yl)oxy-2-(2,4,6-trimethylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide (PubChem CID 164703962) has the molecular formula C41H28N4OPt and a molecular weight of 787.78 g/mol. Its IUPAC name is platinum(2+);11-(3-pyrido[2,3-b]indol-9-ylbenzene-2-id-1-yl)oxy-2-(2,4,6-trimethylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide.
| Compound Name | platinum(2+);11-(3-pyrido[2,3-b]indol-9-ylbenzene-2-id-1-yl)oxy-2-(2,4,6-trimethylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide |
|---|---|
| PubChem CID | 164703962 |
| Molecular Formula | C41H28N4OPt |
| Molecular Weight | 787.78 g/mol |
| Exact Mass | 787.19 |
| IUPAC Name | platinum(2+);11-(3-pyrido[2,3-b]indol-9-ylbenzene-2-id-1-yl)oxy-2-(2,4,6-trimethylphenyl)-12H-imidazo[1,2-f]phenanthridin-12-ide |
| SMILES | Cc1cc(C)c(-c2cn3c4ccccc4c4ccc(Oc5[c-]c(-n6c7ccccc7c7cccnc76)ccc5)[c-]c4c3n2)c(C)c1.[Pt+2] |
| InChI | InChI=1S/C41H28N4O.Pt/c1-25-20-26(2)39(27(3)21-25)36-24-44-37-15-6-4-12-32(37)31-18-17-30(23-35(31)41(44)43-36)46-29-11-8-10-28(22-29)45-38-16-7-5-13-33(38)34-14-9-19-42-40(34)45;/h4-21,24H,1-3H3;/q-2;+2 |
| InChIKey | CHUXXGMIFGJAHU-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 44.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.78 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|