C42H31N5OPt — CID 164704232
CID 164704232 (PubChem CID 164704232) has the molecular formula C42H31N5OPt and a molecular weight of 816.82 g/mol.
| Compound Name | CID 164704232 |
|---|---|
| PubChem CID | 164704232 |
| Molecular Formula | C42H31N5OPt |
| Molecular Weight | 816.82 g/mol |
| Exact Mass | 816.22 |
| IUPAC Name | — |
| SMILES | Cc1ccccc1-c1cn2c(n1)c1[c-]c(Oc3[c-]c4c(cc3)c3ccccc3n4-c3cc(C(C)(C)C)ccn3)ccc1c1cccnc12.[Pt+2] |
| InChI | InChI=1S/C42H31N5O.Pt/c1-26-10-5-6-11-30(26)36-25-46-40-34(13-9-20-44-40)31-17-15-28(23-35(31)41(46)45-36)48-29-16-18-33-32-12-7-8-14-37(32)47(38(33)24-29)39-22-27(19-21-43-39)42(2,3)4;/h5-22,25H,1-4H3;/q-2;+2 |
| InChIKey | BXXSHZVCTIJRTI-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 57.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.82 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|