C60H47N5OPt — CID 162446547
9-(4-tert-butyl-2-pyridinyl)-2-[[9-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]-6-(9-phenylcarbazol-1-yl)-1H-carbazol-1-ide;platinum(2+) (PubChem CID 162446547) has the molecular formula C60H47N5OPt and a molecular weight of 1049.15 g/mol. Its IUPAC name is 9-(4-tert-butyl-2-pyridinyl)-2-[[9-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]-6-(9-phenylcarbazol-1-yl)-1H-carbazol-1-ide;platinum(2+).
| Compound Name | 9-(4-tert-butyl-2-pyridinyl)-2-[[9-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]-6-(9-phenylcarbazol-1-yl)-1H-carbazol-1-ide;platinum(2+) |
|---|---|
| PubChem CID | 162446547 |
| Molecular Formula | C60H47N5OPt |
| Molecular Weight | 1049.15 g/mol |
| Exact Mass | 1048.34 |
| IUPAC Name | 9-(4-tert-butyl-2-pyridinyl)-2-[[9-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]-6-(9-phenylcarbazol-1-yl)-1H-carbazol-1-ide;platinum(2+) |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c5c(cc4)c4cc(-c6cccc7c8ccccc8n(-c8ccccc8)c67)ccc4n5-c4cc(C(C)(C)C)ccn4)ccc3c3ccccc32)c1.[Pt+2] |
| InChI | InChI=1S/C60H47N5O.Pt/c1-59(2,3)39-29-31-61-56(34-39)64-52-22-13-10-17-45(52)47-26-24-42(36-54(47)64)66-43-25-27-48-50-33-38(23-28-53(50)65(55(48)37-43)57-35-40(30-32-62-57)60(4,5)6)44-19-14-20-49-46-18-11-12-21-51(46)63(58(44)49)41-15-8-7-9-16-41;/h7-35H,1-6H3;/q-2;+2 |
| InChIKey | FOGXLKDGZOARKC-UHFFFAOYSA-N |
| XLogP | 15.42 |
| TPSA | 49.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1049.15 |
| LogP ≤ 5 | 15.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|