C78H60N6Pt — CID 162446559
bis(9-(4-tert-butyl-2-pyridinyl)-6-(9-phenylcarbazol-4-yl)-1H-carbazol-1-ide);platinum(2+) (PubChem CID 162446559) has the molecular formula C78H60N6Pt and a molecular weight of 1276.46 g/mol. Its IUPAC name is bis(9-(4-tert-butyl-2-pyridinyl)-6-(9-phenylcarbazol-4-yl)-1H-carbazol-1-ide);platinum(2+).
| Compound Name | bis(9-(4-tert-butyl-2-pyridinyl)-6-(9-phenylcarbazol-4-yl)-1H-carbazol-1-ide);platinum(2+) |
|---|---|
| PubChem CID | 162446559 |
| Molecular Formula | C78H60N6Pt |
| Molecular Weight | 1276.46 g/mol |
| Exact Mass | 1275.45 |
| IUPAC Name | bis(9-(4-tert-butyl-2-pyridinyl)-6-(9-phenylcarbazol-4-yl)-1H-carbazol-1-ide);platinum(2+) |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]cccc3c3cc(-c4cccc5c4c4ccccc4n5-c4ccccc4)ccc32)c1.CC(C)(C)c1ccnc(-n2c3[c-]cccc3c3cc(-c4cccc5c4c4ccccc4n5-c4ccccc4)ccc32)c1.[Pt+2] |
| InChI | InChI=1S/2C39H30N3.Pt/c2*1-39(2,3)27-22-23-40-37(25-27)42-33-17-9-7-14-30(33)32-24-26(20-21-35(32)42)29-16-11-19-36-38(29)31-15-8-10-18-34(31)41(36)28-12-5-4-6-13-28;/h2*4-16,18-25H,1-3H3;/q2*-1;+2 |
| InChIKey | SWRDDAURCVTQRP-UHFFFAOYSA-N |
| XLogP | 20.08 |
| TPSA | 45.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 85 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1276.46 |
| LogP ≤ 5 | 20.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|