C39H28N6OPt — CID 169289161
8-[3-[[9-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]benzene-2-id-1-yl]-1,6,8,10-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-2(7),3,5,9,11,13,15-heptaene;platinum(2+) (PubChem CID 169289161) has the molecular formula C39H28N6OPt and a molecular weight of 791.77 g/mol. Its IUPAC name is 8-[3-[[9-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]benzene-2-id-1-yl]-1,6,8,10-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-2(7),3,5,9,11,13,15-heptaene;platinum(2+).
| Compound Name | 8-[3-[[9-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]benzene-2-id-1-yl]-1,6,8,10-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-2(7),3,5,9,11,13,15-heptaene;platinum(2+) |
|---|---|
| PubChem CID | 169289161 |
| Molecular Formula | C39H28N6OPt |
| Molecular Weight | 791.77 g/mol |
| Exact Mass | 791.20 |
| IUPAC Name | 8-[3-[[9-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]benzene-2-id-1-yl]-1,6,8,10-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-2(7),3,5,9,11,13,15-heptaene;platinum(2+) |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c(-n5c6ncccc6n6c7ccccc7nc56)ccc4)ccc3c3ccccc32)c1.[Pt+2] |
| InChI | InChI=1S/C39H28N6O.Pt/c1-39(2,3)25-19-21-40-36(22-25)44-32-14-6-4-12-29(32)30-18-17-28(24-35(30)44)46-27-11-8-10-26(23-27)43-37-34(16-9-20-41-37)45-33-15-7-5-13-31(33)42-38(43)45;/h4-22H,1-3H3;/q-2;+2 |
| InChIKey | FMPNXTQFDKTGFA-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 62.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.77 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|