C44H38N4OPt-2 — CID 170517399
2-[3-[3-(3-tert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]benzene-2-id-1-yl]oxy-9-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-ide;platinum (PubChem CID 170517399) has the molecular formula C44H38N4OPt-2 and a molecular weight of 833.89 g/mol. Its IUPAC name is 2-[3-[3-(3-tert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]benzene-2-id-1-yl]oxy-9-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-ide;platinum.
| Compound Name | 2-[3-[3-(3-tert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]benzene-2-id-1-yl]oxy-9-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-ide;platinum |
|---|---|
| PubChem CID | 170517399 |
| Molecular Formula | C44H38N4OPt-2 |
| Molecular Weight | 833.89 g/mol |
| Exact Mass | 833.27 |
| IUPAC Name | 2-[3-[3-(3-tert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]benzene-2-id-1-yl]oxy-9-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-ide;platinum |
| SMILES | CC(C)(C)c1cccc(-[n+]2[c-]n(-c3[c-]c(Oc4[c-]c5c(cc4)c4ccccc4n5-c4cc(C(C)(C)C)ccn4)ccc3)c3ccccc32)c1.[Pt] |
| InChI | InChI=1S/C44H38N4O.Pt/c1-43(2,3)30-13-11-14-32(25-30)46-29-47(40-20-10-9-19-39(40)46)33-15-12-16-34(27-33)49-35-21-22-37-36-17-7-8-18-38(36)48(41(37)28-35)42-26-31(23-24-45-42)44(4,5)6;/h7-26H,1-6H3;/q-2; |
| InChIKey | XDNWUWVZDLPFFE-UHFFFAOYSA-N |
| XLogP | 10.18 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.89 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|