C52H40N4OPtSi-2 — CID 171057272
[3-[3-[[9-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]benzene-2-id-1-yl]-2H-benzimidazol-1-ium-2-id-1-yl]-triphenylsilane;platinum (PubChem CID 171057272) has the molecular formula C52H40N4OPtSi-2 and a molecular weight of 960.08 g/mol. Its IUPAC name is [3-[3-[[9-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]benzene-2-id-1-yl]-2H-benzimidazol-1-ium-2-id-1-yl]-triphenylsilane;platinum.
| Compound Name | [3-[3-[[9-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]benzene-2-id-1-yl]-2H-benzimidazol-1-ium-2-id-1-yl]-triphenylsilane;platinum |
|---|---|
| PubChem CID | 171057272 |
| Molecular Formula | C52H40N4OPtSi-2 |
| Molecular Weight | 960.08 g/mol |
| Exact Mass | 959.26 |
| IUPAC Name | [3-[3-[[9-(4-tert-butyl-2-pyridinyl)-1H-carbazol-1-id-2-yl]oxy]benzene-2-id-1-yl]-2H-benzimidazol-1-ium-2-id-1-yl]-triphenylsilane;platinum |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c(-n5[c-][n+]([Si](c6ccccc6)(c6ccccc6)c6ccccc6)c6ccccc65)ccc4)ccc3c3ccccc32)c1.[Pt] |
| InChI | InChI=1S/C52H40N4OSi.Pt/c1-52(2,3)38-32-33-53-51(34-38)56-47-27-14-13-26-45(47)46-31-30-41(36-50(46)56)57-40-19-17-18-39(35-40)54-37-55(49-29-16-15-28-48(49)54)58(42-20-7-4-8-21-42,43-22-9-5-10-23-43)44-24-11-6-12-25-44;/h4-34H,1-3H3;/q-2; |
| InChIKey | ZRBKZWVPMUYPQN-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 960.08 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|