C60H39N5OPt — CID 168811460
CID 168811460 (PubChem CID 168811460) has the molecular formula C60H39N5OPt and a molecular weight of 1041.08 g/mol.
| Compound Name | CID 168811460 |
|---|---|
| PubChem CID | 168811460 |
| Molecular Formula | C60H39N5OPt |
| Molecular Weight | 1041.08 g/mol |
| Exact Mass | 1040.28 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c5c(cc4)c4ccccc4n4c5nc5c6ccccc6n6c7ccccc7c7cccc(c8ccccc8c54)c76)ccc3c3ccccc32)c1.[Pt+2] |
| InChI | InChI=1S/C60H39N5O.Pt/c1-60(2,3)36-31-32-61-55(33-36)63-50-23-10-7-17-42(50)44-30-28-38(35-54(44)63)66-37-27-29-40-41-16-6-12-25-52(41)65-58-46-19-5-4-15-39(46)45-21-14-22-47-43-18-8-11-24-51(43)64(57(45)47)53-26-13-9-20-48(53)56(58)62-59(65)49(40)34-37;/h4-33H,1-3H3;/q-2;+2 |
| InChIKey | LNLTWSRPCQLRFG-UHFFFAOYSA-N |
| XLogP | 15.40 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1041.08 |
| LogP ≤ 5 | 15.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|