C36H26N4OPt — CID 154610586
5-tert-butyl-11-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]-12H-imidazo[1,2-f]phenanthridin-12-ide;platinum(2+) (PubChem CID 154610586) has the molecular formula C36H26N4OPt and a molecular weight of 725.71 g/mol. Its IUPAC name is 5-tert-butyl-11-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]-12H-imidazo[1,2-f]phenanthridin-12-ide;platinum(2+).
| Compound Name | 5-tert-butyl-11-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]-12H-imidazo[1,2-f]phenanthridin-12-ide;platinum(2+) |
|---|---|
| PubChem CID | 154610586 |
| Molecular Formula | C36H26N4OPt |
| Molecular Weight | 725.71 g/mol |
| Exact Mass | 725.18 |
| IUPAC Name | 5-tert-butyl-11-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]-12H-imidazo[1,2-f]phenanthridin-12-ide;platinum(2+) |
| SMILES | CC(C)(C)c1cccc2c3ccc(Oc4[c-]c5c(cc4)c4ccccc4n5-c4ccccn4)[c-]c3c3nccn3c12.[Pt+2] |
| InChI | InChI=1S/C36H26N4O.Pt/c1-36(2,3)30-11-8-10-28-25-16-14-23(21-29(25)35-38-19-20-39(35)34(28)30)41-24-15-17-27-26-9-4-5-12-31(26)40(32(27)22-24)33-13-6-7-18-37-33;/h4-20H,1-3H3;/q-2;+2 |
| InChIKey | GCRPWMCUZOSVAD-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 44.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.71 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|