About CID 154610877
CID 154610877 (PubChem CID 154610877) has the molecular formula C42H24N4OPd
and a molecular weight of 707.10 g/mol.
Molecular Properties
| Compound Name | CID 154610877 |
| PubChem CID | 154610877 |
| Molecular Formula | C42H24N4OPd |
| Molecular Weight | 707.10 g/mol |
| Exact Mass | 706.10 |
| IUPAC Name | — |
| SMILES | [Pd+2].[c-]1c(Oc2[c-]c3c(cc2)c2ccccc2n3-c2ccccn2)ccc2c1c1nc3ccccc3n1c1c(-c3ccccc3)cccc21 |
| InChI | InChI=1S/C42H24N4O.Pd/c1-2-11-27(12-3-1)30-14-10-15-34-31-22-20-28(25-35(31)42-44-36-16-5-7-18-38(36)46(42)41(30)34)47-29-21-23-33-32-13-4-6-17-37(32)45(39(33)26-29)40-19-8-9-24-43-40;/h1-24H;/q-2;+2 |
| InChIKey | CTCMSMSVTKUZAP-UHFFFAOYSA-N |
| XLogP | 10.34 |
| TPSA | 44.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 707.10 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 154610877 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 154610877?
The IUPAC name of CID 154610877 (CID 154610877) is not available.
What is the SMILES notation for CID 154610877?
The canonical SMILES for CID 154610877 is [Pd+2].[c-]1c(Oc2[c-]c3c(cc2)c2ccccc2n3-c2ccccn2)ccc2c1c1nc3ccccc3n1c1c(-c3ccccc3)cccc21.
What is the InChIKey of CID 154610877?
The InChIKey is CTCMSMSVTKUZAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C42H24N4O.Pd/c1-2-11-27(12-3-1)30-14-10-15-34-31-22-20-28(25-35(31)42-44-36-16-5-7-18-38(36)46(42)41(30)34)47-29-21-23-33-32-13-4-6-17-37(32)45(39(33)26-29)40-19-8-9-24-43-40;/h1-24H;/q-2;+2.
What are the key properties of CID 154610877?
CID 154610877 has a molecular weight of 707.10 g/mol, XLogP of 10.34, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 154610877 is sourced from PubChem (CID 154610877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).