C42H24N6OPt — CID 153411601
3-(2-phenylphenyl)-11-[(9-pyridin-2-yl-8H-pyrido[3,4-b]indol-8-id-7-yl)oxy]-12H-[1,2,4]triazolo[4,3-f]phenanthridin-12-ide;platinum(2+) (PubChem CID 153411601) has the molecular formula C42H24N6OPt and a molecular weight of 823.77 g/mol. Its IUPAC name is 3-(2-phenylphenyl)-11-[(9-pyridin-2-yl-8H-pyrido[3,4-b]indol-8-id-7-yl)oxy]-12H-[1,2,4]triazolo[4,3-f]phenanthridin-12-ide;platinum(2+).
| Compound Name | 3-(2-phenylphenyl)-11-[(9-pyridin-2-yl-8H-pyrido[3,4-b]indol-8-id-7-yl)oxy]-12H-[1,2,4]triazolo[4,3-f]phenanthridin-12-ide;platinum(2+) |
|---|---|
| PubChem CID | 153411601 |
| Molecular Formula | C42H24N6OPt |
| Molecular Weight | 823.77 g/mol |
| Exact Mass | 823.17 |
| IUPAC Name | 3-(2-phenylphenyl)-11-[(9-pyridin-2-yl-8H-pyrido[3,4-b]indol-8-id-7-yl)oxy]-12H-[1,2,4]triazolo[4,3-f]phenanthridin-12-ide;platinum(2+) |
| SMILES | [Pt+2].[c-]1c(Oc2[c-]c3c(cc2)c2ccncc2n3-c2ccccn2)ccc2c1c1nnc(-c3ccccc3-c3ccccc3)n1c1ccccc21 |
| InChI | InChI=1S/C42H24N6O.Pt/c1-2-10-27(11-3-1)30-12-4-5-14-35(30)41-45-46-42-36-24-28(17-19-31(36)32-13-6-7-15-37(32)48(41)42)49-29-18-20-33-34-21-23-43-26-39(34)47(38(33)25-29)40-16-8-9-22-44-40;/h1-23,26H;/q-2;+2 |
| InChIKey | FRHPMRPHVRTLFO-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 70.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.77 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|