C56H42N4OPt — CID 154611558
platinum(2+);3,5,7-tris(2,6-dimethylphenyl)-11-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]-12H-imidazo[1,2-f]phenanthridin-12-ide (PubChem CID 154611558) has the molecular formula C56H42N4OPt and a molecular weight of 982.06 g/mol. Its IUPAC name is platinum(2+);3,5,7-tris(2,6-dimethylphenyl)-11-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]-12H-imidazo[1,2-f]phenanthridin-12-ide.
| Compound Name | platinum(2+);3,5,7-tris(2,6-dimethylphenyl)-11-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]-12H-imidazo[1,2-f]phenanthridin-12-ide |
|---|---|
| PubChem CID | 154611558 |
| Molecular Formula | C56H42N4OPt |
| Molecular Weight | 982.06 g/mol |
| Exact Mass | 981.30 |
| IUPAC Name | platinum(2+);3,5,7-tris(2,6-dimethylphenyl)-11-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]-12H-imidazo[1,2-f]phenanthridin-12-ide |
| SMILES | Cc1cccc(C)c1-c1cc(-c2c(C)cccc2C)c2c(c1)c1ccc(Oc3[c-]c4c(cc3)c3ccccc3n4-c3ccccn3)[c-]c1c1ncc(-c3c(C)cccc3C)n12.[Pt+2] |
| InChI | InChI=1S/C56H42N4O.Pt/c1-33-14-11-15-34(2)52(33)39-28-45-42-25-23-40(61-41-24-26-44-43-20-7-8-21-48(43)59(49(44)31-41)51-22-9-10-27-57-51)30-46(42)56-58-32-50(54-37(5)18-13-19-38(54)6)60(56)55(45)47(29-39)53-35(3)16-12-17-36(53)4;/h7-29,32H,1-6H3;/q-2;+2 |
| InChIKey | HZQCIPXVBJBKDQ-UHFFFAOYSA-N |
| XLogP | 14.37 |
| TPSA | 44.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 982.06 |
| LogP ≤ 5 | 14.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|