C48H28N4OPd — CID 170672584
CID 170672584 (PubChem CID 170672584) has the molecular formula C48H28N4OPd and a molecular weight of 783.20 g/mol.
| Compound Name | CID 170672584 |
|---|---|
| PubChem CID | 170672584 |
| Molecular Formula | C48H28N4OPd |
| Molecular Weight | 783.20 g/mol |
| Exact Mass | 782.13 |
| IUPAC Name | — |
| SMILES | [Pd+2].[c-]1c(Oc2[c-]c3c(cc2)c2ccccc2n3-c2ccccn2)ccc2c1c1nc3ccccc3n1c1c(-c3ccccc3)c(-c3ccccc3)ccc21 |
| InChI | InChI=1S/C48H28N4O.Pd/c1-3-13-31(14-4-1)35-26-27-39-36-24-22-33(53-34-23-25-38-37-17-7-9-19-42(37)51(44(38)30-34)45-21-11-12-28-49-45)29-40(36)48-50-41-18-8-10-20-43(41)52(48)47(39)46(35)32-15-5-2-6-16-32;/h1-28H;/q-2;+2 |
| InChIKey | XEXPCZIIOYYWAY-UHFFFAOYSA-N |
| XLogP | 12.01 |
| TPSA | 44.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.20 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|