C41H22N6OPt — CID 171436271
CID 171436271 (PubChem CID 171436271) has the molecular formula C41H22N6OPt and a molecular weight of 809.75 g/mol.
| Compound Name | CID 171436271 |
|---|---|
| PubChem CID | 171436271 |
| Molecular Formula | C41H22N6OPt |
| Molecular Weight | 809.75 g/mol |
| Exact Mass | 809.15 |
| IUPAC Name | — |
| SMILES | [Pt+2].[c-]1c(Oc2[c-]c3c(cc2)nc2n3c3nccc4c5ccccc5c5ccccc5n2c43)ccc2c3ccccc3n(-c3ccccn3)c12 |
| InChI | InChI=1S/C41H22N6O.Pt/c1-2-10-28-27(9-1)29-11-3-6-14-35(29)46-39-32(28)20-22-43-40(39)47-37-24-26(17-19-33(37)44-41(46)47)48-25-16-18-31-30-12-4-5-13-34(30)45(36(31)23-25)38-15-7-8-21-42-38;/h1-22H;/q-2;+2 |
| InChIKey | FYCGVIUQQYEFPC-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 61.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.75 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|