C32H19N5OPt — CID 153411698
2-methyl-11-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]-12H-[1,2,4]triazolo[1,5-f]phenanthridin-12-ide;platinum(2+) (PubChem CID 153411698) has the molecular formula C32H19N5OPt and a molecular weight of 684.62 g/mol. Its IUPAC name is 2-methyl-11-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]-12H-[1,2,4]triazolo[1,5-f]phenanthridin-12-ide;platinum(2+).
| Compound Name | 2-methyl-11-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]-12H-[1,2,4]triazolo[1,5-f]phenanthridin-12-ide;platinum(2+) |
|---|---|
| PubChem CID | 153411698 |
| Molecular Formula | C32H19N5OPt |
| Molecular Weight | 684.62 g/mol |
| Exact Mass | 684.12 |
| IUPAC Name | 2-methyl-11-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]-12H-[1,2,4]triazolo[1,5-f]phenanthridin-12-ide;platinum(2+) |
| SMILES | Cc1nc2c3[c-]c(Oc4[c-]c5c(cc4)c4ccccc4n5-c4ccccn4)ccc3c3ccccc3n2n1.[Pt+2] |
| InChI | InChI=1S/C32H19N5O.Pt/c1-20-34-32-27-18-21(13-15-23(27)24-8-3-5-11-29(24)37(32)35-20)38-22-14-16-26-25-9-2-4-10-28(25)36(30(26)19-22)31-12-6-7-17-33-31;/h2-17H,1H3;/q-2;+2 |
| InChIKey | JNDZYXDOYZDMQQ-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 57.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.62 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|