C44H25N5OPt — CID 162487067
CID 162487067 (PubChem CID 162487067) has the molecular formula C44H25N5OPt and a molecular weight of 834.80 g/mol.
| Compound Name | CID 162487067 |
|---|---|
| PubChem CID | 162487067 |
| Molecular Formula | C44H25N5OPt |
| Molecular Weight | 834.80 g/mol |
| Exact Mass | 834.17 |
| IUPAC Name | — |
| SMILES | [Pt+2].[c-]1c(Oc2[c-]c3c(cc2)c2ccccc2n3-c2ccccn2)ccc2c1c1nccn1c1cc3c(cc21)c1ccccc1n3-c1ccccc1 |
| InChI | InChI=1S/C44H25N5O.Pt/c1-2-10-28(11-3-1)48-38-14-6-5-13-33(38)36-26-35-31-19-17-29(24-37(31)44-46-22-23-47(44)40(35)27-42(36)48)50-30-18-20-34-32-12-4-7-15-39(32)49(41(34)25-30)43-16-8-9-21-45-43;/h1-23,26-27H;/q-2;+2 |
| InChIKey | OJONSBLFUSCJCK-UHFFFAOYSA-N |
| XLogP | 10.62 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.80 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|