C34H24N4OPt — CID 154611149
6-tert-butyl-11-(12H-imidazo[1,2-f]phenanthridin-12-id-11-yloxy)-12H-imidazo[1,2-f]phenanthridin-12-ide;platinum(2+) (PubChem CID 154611149) has the molecular formula C34H24N4OPt and a molecular weight of 699.67 g/mol. Its IUPAC name is 6-tert-butyl-11-(12H-imidazo[1,2-f]phenanthridin-12-id-11-yloxy)-12H-imidazo[1,2-f]phenanthridin-12-ide;platinum(2+).
| Compound Name | 6-tert-butyl-11-(12H-imidazo[1,2-f]phenanthridin-12-id-11-yloxy)-12H-imidazo[1,2-f]phenanthridin-12-ide;platinum(2+) |
|---|---|
| PubChem CID | 154611149 |
| Molecular Formula | C34H24N4OPt |
| Molecular Weight | 699.67 g/mol |
| Exact Mass | 699.16 |
| IUPAC Name | 6-tert-butyl-11-(12H-imidazo[1,2-f]phenanthridin-12-id-11-yloxy)-12H-imidazo[1,2-f]phenanthridin-12-ide;platinum(2+) |
| SMILES | CC(C)(C)c1ccc2c3ccc(Oc4[c-]c5c(cc4)c4ccccc4n4ccnc54)[c-]c3c3nccn3c2c1.[Pt+2] |
| InChI | InChI=1S/C34H24N4O.Pt/c1-34(2,3)21-8-11-27-25-13-10-23(20-29(25)33-36-15-17-38(33)31(27)18-21)39-22-9-12-24-26-6-4-5-7-30(26)37-16-14-35-32(37)28(24)19-22;/h4-18H,1-3H3;/q-2;+2 |
| InChIKey | UDFXXTOWYVVLDS-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 43.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.67 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|