C37H23N5OPt — CID 154611572
CID 154611572 (PubChem CID 154611572) has the molecular formula C37H23N5OPt and a molecular weight of 748.70 g/mol.
| Compound Name | CID 154611572 |
|---|---|
| PubChem CID | 154611572 |
| Molecular Formula | C37H23N5OPt |
| Molecular Weight | 748.70 g/mol |
| Exact Mass | 748.16 |
| IUPAC Name | — |
| SMILES | Cc1cccc(C)c1-c1ccc2c3ccc(Oc4[c-]c5c(cc4)c4cccnc4n4ccnc54)[c-]c3c3nccn3c2c1.[Pt+2] |
| InChI | InChI=1S/C37H23N5O.Pt/c1-22-5-3-6-23(2)34(22)24-8-11-29-27-12-9-25(20-31(27)36-39-15-17-41(36)33(29)19-24)43-26-10-13-28-30-7-4-14-38-35(30)42-18-16-40-37(42)32(28)21-26;/h3-19H,1-2H3;/q-2;+2 |
| InChIKey | RSDOJQRAZICRDK-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 56.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.70 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|