C44H30N6OPt — CID 154611242
CID 154611242 (PubChem CID 154611242) has the molecular formula C44H30N6OPt and a molecular weight of 853.84 g/mol.
| Compound Name | CID 154611242 |
|---|---|
| PubChem CID | 154611242 |
| Molecular Formula | C44H30N6OPt |
| Molecular Weight | 853.84 g/mol |
| Exact Mass | 853.21 |
| IUPAC Name | — |
| SMILES | Cc1cccc(C)c1-c1cc2c3ccc(Oc4[c-]c5c(cc4)c4nccnc4n4ccnc54)[c-]c3c3nccn3c2cc1-c1c(C)cccc1C.[Pt+2] |
| InChI | InChI=1S/C44H30N6O.Pt/c1-25-7-5-8-26(2)39(25)34-23-33-31-13-11-29(51-30-12-14-32-37(22-30)43-48-18-20-50(43)44-41(32)45-15-16-46-44)21-36(31)42-47-17-19-49(42)38(33)24-35(34)40-27(3)9-6-10-28(40)4;/h5-20,23-24H,1-4H3;/q-2;+2 |
| InChIKey | GASVCSIDECBFGK-UHFFFAOYSA-N |
| XLogP | 10.34 |
| TPSA | 69.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.84 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|