C40H26N4OPt — CID 154610895
8-(2,6-dimethylphenyl)-11-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]-12H-imidazo[1,2-f]phenanthridin-12-ide;platinum(2+) (PubChem CID 154610895) has the molecular formula C40H26N4OPt and a molecular weight of 773.75 g/mol. Its IUPAC name is 8-(2,6-dimethylphenyl)-11-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]-12H-imidazo[1,2-f]phenanthridin-12-ide;platinum(2+).
| Compound Name | 8-(2,6-dimethylphenyl)-11-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]-12H-imidazo[1,2-f]phenanthridin-12-ide;platinum(2+) |
|---|---|
| PubChem CID | 154610895 |
| Molecular Formula | C40H26N4OPt |
| Molecular Weight | 773.75 g/mol |
| Exact Mass | 773.18 |
| IUPAC Name | 8-(2,6-dimethylphenyl)-11-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]-12H-imidazo[1,2-f]phenanthridin-12-ide;platinum(2+) |
| SMILES | Cc1cccc(C)c1-c1cccc2c1c1ccc(Oc3[c-]c4c(cc3)c3ccccc3n4-c3ccccn3)[c-]c1c1nccn21.[Pt+2] |
| InChI | InChI=1S/C40H26N4O.Pt/c1-25-9-7-10-26(2)38(25)32-12-8-14-35-39(32)31-19-17-27(23-33(31)40-42-21-22-43(35)40)45-28-16-18-30-29-11-3-4-13-34(29)44(36(30)24-28)37-15-5-6-20-41-37;/h3-22H,1-2H3;/q-2;+2 |
| InChIKey | MFXPMVMMDAZZPZ-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 44.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.75 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|