About CID 154610679
CID 154610679 (PubChem CID 154610679) has the molecular formula C35H19N5OPt
and a molecular weight of 720.65 g/mol.
Molecular Properties
| Compound Name | CID 154610679 |
| PubChem CID | 154610679 |
| Molecular Formula | C35H19N5OPt |
| Molecular Weight | 720.65 g/mol |
| Exact Mass | 720.12 |
| IUPAC Name | — |
| SMILES | [Pt+2].[c-]1c(Oc2[c-]c3c(cc2)c2c(-c4ccccc4)cccc2n2ccnc32)ccc2c1c1nccn1c1cccnc21 |
| InChI | InChI=1S/C35H19N5O.Pt/c1-2-6-22(7-3-1)25-8-4-9-30-32(25)26-13-11-23(20-28(26)34-37-16-18-39(30)34)41-24-12-14-27-29(21-24)35-38-17-19-40(35)31-10-5-15-36-33(27)31;/h1-19H;/q-2;+2 |
| InChIKey | MPVASQZQMTUHHX-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 56.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 720.65 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 154610679 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 154610679?
The IUPAC name of CID 154610679 (CID 154610679) is not available.
What is the SMILES notation for CID 154610679?
The canonical SMILES for CID 154610679 is [Pt+2].[c-]1c(Oc2[c-]c3c(cc2)c2c(-c4ccccc4)cccc2n2ccnc32)ccc2c1c1nccn1c1cccnc21.
What is the InChIKey of CID 154610679?
The InChIKey is MPVASQZQMTUHHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H19N5O.Pt/c1-2-6-22(7-3-1)25-8-4-9-30-32(25)26-13-11-23(20-28(26)34-37-16-18-39(30)34)41-24-12-14-27-29(21-24)35-38-17-19-40(35)31-10-5-15-36-33(27)31;/h1-19H;/q-2;+2.
What are the key properties of CID 154610679?
CID 154610679 has a molecular weight of 720.65 g/mol, XLogP of 8.05, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 154610679 is sourced from PubChem (CID 154610679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).