C35H25N5OPt — CID 154610691
CID 154610691 (PubChem CID 154610691) has the molecular formula C35H25N5OPt and a molecular weight of 726.70 g/mol.
| Compound Name | CID 154610691 |
|---|---|
| PubChem CID | 154610691 |
| Molecular Formula | C35H25N5OPt |
| Molecular Weight | 726.70 g/mol |
| Exact Mass | 726.17 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc2c3ccc(Oc4[c-]c5c(cc4)c4ccccc4n5-c4ccccn4)[c-]c3c3nccn3c2n1.[Pt+2] |
| InChI | InChI=1S/C35H25N5O.Pt/c1-35(2,3)31-16-15-27-24-13-11-22(20-28(24)33-37-18-19-39(33)34(27)38-31)41-23-12-14-26-25-8-4-5-9-29(25)40(30(26)21-23)32-10-6-7-17-36-32;/h4-19H,1-3H3;/q-2;+2 |
| InChIKey | SADYRQJUJKAKKH-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 57.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.70 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|