About CID 154610651
CID 154610651 (PubChem CID 154610651) has the molecular formula C44H30N6OPt
and a molecular weight of 853.84 g/mol.
Molecular Properties
| Compound Name | CID 154610651 |
| PubChem CID | 154610651 |
| Molecular Formula | C44H30N6OPt |
| Molecular Weight | 853.84 g/mol |
| Exact Mass | 853.21 |
| IUPAC Name | — |
| SMILES | Cc1cccc(C)c1-c1ccc2c3ccc(Oc4[c-]c5c(cc4)c4ccc(-c6c(C)cccc6C)nc4n4ccnc54)[c-]c3c3nccn3c2n1.[Pt+2] |
| InChI | InChI=1S/C44H30N6O.Pt/c1-25-7-5-8-26(2)39(25)37-17-15-33-31-13-11-29(23-35(31)41-45-19-21-49(41)43(33)47-37)51-30-12-14-32-34-16-18-38(40-27(3)9-6-10-28(40)4)48-44(34)50-22-20-46-42(50)36(32)24-30;/h5-22H,1-4H3;/q-2;+2 |
| InChIKey | HKRQZOXRIMMFTF-UHFFFAOYSA-N |
| XLogP | 10.34 |
| TPSA | 69.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 853.84 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 154610651 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 154610651?
The IUPAC name of CID 154610651 (CID 154610651) is not available.
What is the SMILES notation for CID 154610651?
The canonical SMILES for CID 154610651 is Cc1cccc(C)c1-c1ccc2c3ccc(Oc4[c-]c5c(cc4)c4ccc(-c6c(C)cccc6C)nc4n4ccnc54)[c-]c3c3nccn3c2n1.[Pt+2].
What is the InChIKey of CID 154610651?
The InChIKey is HKRQZOXRIMMFTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C44H30N6O.Pt/c1-25-7-5-8-26(2)39(25)37-17-15-33-31-13-11-29(23-35(31)41-45-19-21-49(41)43(33)47-37)51-30-12-14-32-34-16-18-38(40-27(3)9-6-10-28(40)4)48-44(34)50-22-20-46-42(50)36(32)24-30;/h5-22H,1-4H3;/q-2;+2.
What are the key properties of CID 154610651?
CID 154610651 has a molecular weight of 853.84 g/mol, XLogP of 10.34, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 154610651 is sourced from PubChem (CID 154610651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).