C36H18N4OPdS — CID 162487227
CID 162487227 (PubChem CID 162487227) has the molecular formula C36H18N4OPdS and a molecular weight of 661.05 g/mol.
| Compound Name | CID 162487227 |
|---|---|
| PubChem CID | 162487227 |
| Molecular Formula | C36H18N4OPdS |
| Molecular Weight | 661.05 g/mol |
| Exact Mass | 660.02 |
| IUPAC Name | — |
| SMILES | [Pd+2].[c-]1c(Oc2[c-]c3c(cc2)c2cc4sc5ccccc5c4cc2n2ccnc32)ccc2c1c1nccn1c1ccccc21 |
| InChI | InChI=1S/C36H18N4OS.Pd/c1-3-7-31-25(5-1)23-11-9-21(17-29(23)35-37-13-15-39(31)35)41-22-10-12-24-27-20-34-28(26-6-2-4-8-33(26)42-34)19-32(27)40-16-14-38-36(40)30(24)18-22;/h1-16,19-20H;/q-2;+2 |
| InChIKey | ZYBQYRYJIXIOCG-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 43.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.05 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|