C35H22N4OPt-2 — CID 164761033
2-[[9-(1-methanidylpyridin-1-ium-2-yl)-1H-carbazol-1-id-2-yl]oxy]-9-pyridin-2-yl-1H-carbazol-1-ide;platinum (PubChem CID 164761033) has the molecular formula C35H22N4OPt-2 and a molecular weight of 709.67 g/mol. Its IUPAC name is 2-[[9-(1-methanidylpyridin-1-ium-2-yl)-1H-carbazol-1-id-2-yl]oxy]-9-pyridin-2-yl-1H-carbazol-1-ide;platinum.
| Compound Name | 2-[[9-(1-methanidylpyridin-1-ium-2-yl)-1H-carbazol-1-id-2-yl]oxy]-9-pyridin-2-yl-1H-carbazol-1-ide;platinum |
|---|---|
| PubChem CID | 164761033 |
| Molecular Formula | C35H22N4OPt-2 |
| Molecular Weight | 709.67 g/mol |
| Exact Mass | 709.15 |
| IUPAC Name | 2-[[9-(1-methanidylpyridin-1-ium-2-yl)-1H-carbazol-1-id-2-yl]oxy]-9-pyridin-2-yl-1H-carbazol-1-ide;platinum |
| SMILES | [CH2-][n+]1ccccc1-n1c2[c-]c(Oc3[c-]c4c(cc3)c3ccccc3n4-c3ccccn3)ccc2c2ccccc21.[Pt] |
| InChI | InChI=1S/C35H22N4O.Pt/c1-37-21-9-7-15-35(37)39-31-13-5-3-11-27(31)29-19-17-25(23-33(29)39)40-24-16-18-28-26-10-2-4-12-30(26)38(32(28)22-24)34-14-6-8-20-36-34;/h2-21H,1H2;/q-2; |
| InChIKey | YXVKJPKTGPJXHJ-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.67 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|