C30H20N5OPt-3 — CID 164801839
2-[3-(3-methylbenzotriazol-2-id-1-yl)benzene-2-id-1-yl]oxy-9-pyridin-2-yl-1H-carbazol-1-ide;platinum (PubChem CID 164801839) has the molecular formula C30H20N5OPt-3 and a molecular weight of 661.60 g/mol. Its IUPAC name is 2-[3-(3-methylbenzotriazol-2-id-1-yl)benzene-2-id-1-yl]oxy-9-pyridin-2-yl-1H-carbazol-1-ide;platinum.
| Compound Name | 2-[3-(3-methylbenzotriazol-2-id-1-yl)benzene-2-id-1-yl]oxy-9-pyridin-2-yl-1H-carbazol-1-ide;platinum |
|---|---|
| PubChem CID | 164801839 |
| Molecular Formula | C30H20N5OPt-3 |
| Molecular Weight | 661.60 g/mol |
| Exact Mass | 661.13 |
| IUPAC Name | 2-[3-(3-methylbenzotriazol-2-id-1-yl)benzene-2-id-1-yl]oxy-9-pyridin-2-yl-1H-carbazol-1-ide;platinum |
| SMILES | CN1[N-]N(c2[c-]c(Oc3[c-]c4c(cc3)c3ccccc3n4-c3ccccn3)ccc2)c2ccccc21.[Pt] |
| InChI | InChI=1S/C30H20N5O.Pt/c1-33-27-13-4-5-14-28(27)35(32-33)21-9-8-10-22(19-21)36-23-16-17-25-24-11-2-3-12-26(24)34(29(25)20-23)30-15-6-7-18-31-30;/h2-18H,1H3;/q-3; |
| InChIKey | MUKVJQWDOIABSH-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 47.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.60 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|