C30H15N3OPtS2 — CID 155650074
CID 155650074 (PubChem CID 155650074) has the molecular formula C30H15N3OPtS2 and a molecular weight of 692.68 g/mol.
| Compound Name | CID 155650074 |
|---|---|
| PubChem CID | 155650074 |
| Molecular Formula | C30H15N3OPtS2 |
| Molecular Weight | 692.68 g/mol |
| Exact Mass | 692.03 |
| IUPAC Name | — |
| SMILES | [Pt+2].[c-]1c(Oc2[c-]c3c(cc2)c2ccccc2n3-c2ccccn2)ccc2sc3sc4cccnc4c3c12 |
| InChI | InChI=1S/C30H15N3OS2.Pt/c1-2-7-23-20(6-1)21-12-10-19(17-24(21)33(23)27-9-3-4-14-31-27)34-18-11-13-25-22(16-18)28-29-26(8-5-15-32-29)36-30(28)35-25;/h1-15H;/q-2;+2 |
| InChIKey | NYBUCKMQWYHGBH-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.68 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|