C31H15N7OPt — CID 153411524
8-isocyano-11-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]-12H-tetrazolo[1,5-f]phenanthridin-12-ide;platinum(2+) (PubChem CID 153411524) has the molecular formula C31H15N7OPt and a molecular weight of 696.59 g/mol. Its IUPAC name is 8-isocyano-11-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]-12H-tetrazolo[1,5-f]phenanthridin-12-ide;platinum(2+).
| Compound Name | 8-isocyano-11-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]-12H-tetrazolo[1,5-f]phenanthridin-12-ide;platinum(2+) |
|---|---|
| PubChem CID | 153411524 |
| Molecular Formula | C31H15N7OPt |
| Molecular Weight | 696.59 g/mol |
| Exact Mass | 696.10 |
| IUPAC Name | 8-isocyano-11-[(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)oxy]-12H-tetrazolo[1,5-f]phenanthridin-12-ide;platinum(2+) |
| SMILES | [C-]#[N+]c1cccc2c1c1ccc(Oc3[c-]c4c(cc3)c3ccccc3n4-c3ccccn3)[c-]c1c1nnnn21.[Pt+2] |
| InChI | InChI=1S/C31H15N7O.Pt/c1-32-25-8-6-10-27-30(25)23-15-13-19(17-24(23)31-34-35-36-38(27)31)39-20-12-14-22-21-7-2-3-9-26(21)37(28(22)18-20)29-11-4-5-16-33-29;/h2-16H;/q-2;+2 |
| InChIKey | JGDFSGDRHQICNT-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.59 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|